|
|
| | OTAVA-BB BB7018670037 Basic information |
| Product Name: | OTAVA-BB BB7018670037 | | Synonyms: | OTAVA-BB BB7018670037;2,5,8-TRIMETHYL-4-QUINOLINOL;AKOS BBS-00009384;OTAVA-BB 7018670037;4-Hydroxy-2,5,8-trimethylquinoline;2,5,8-trimethylquinolin-4-ol;5,8-dimethyl-4-hydroxyquinaldine;2,5,8-Trimethylquinolin-4(1H)-one | | CAS: | 500350-48-1 | | MF: | C12H13NO | | MW: | 187.24 | | EINECS: | | | Product Categories: | | | Mol File: | 500350-48-1.mol |  |
| | OTAVA-BB BB7018670037 Chemical Properties |
| Boiling point | 340.9±37.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | pka | 4.76±0.40(Predicted) | | form | solid | | InChI | 1S/C12H13NO/c1-7-4-5-8(2)12-11(7)10(14)6-9(3)13-12/h4-6H,1-3H3,(H,13,14) | | InChIKey | JTVSWQVZPILKJO-UHFFFAOYSA-N | | SMILES | OC1=CC(C)=NC2=C(C)C=CC(C)=C21 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | OTAVA-BB BB7018670037 Usage And Synthesis |
| | OTAVA-BB BB7018670037 Preparation Products And Raw materials |
|