2,7-dimethyl-2,6-octadiene manufacturers
- Geraniol
-
- $10.00
-
2026-05-28
- CAS:16736-42-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10 ton
|
| | 2,7-dimethyl-2,6-octadiene Basic information |
| Product Name: | 2,7-dimethyl-2,6-octadiene | | Synonyms: | LEMONOL;(E)-3,7-DIMETHYL-2,6-OCTADIEN-1-OL;FEMA 2507;GERANIOL 60;GERANIOL 600;GERANIOL 70;GERANIOL 80;GERANIOL 90 | | CAS: | 16736-42-8 | | MF: | C10H18 | | MW: | 138.25 | | EINECS: | 203-377-1 | | Product Categories: | | | Mol File: | 16736-42-8.mol |  |
| | 2,7-dimethyl-2,6-octadiene Chemical Properties |
| Melting point | -74.4°C | | Boiling point | 229-230 °C(lit.) | | density | 0.879 g/mL at 20 °C(lit.) | | vapor density | 5.31 (vs air) | | vapor pressure | ~0.2 mm Hg ( 20 °C) | | refractive index | n20/D 1.474(lit.) | | Fp | 216 °F | | storage temp. | 2-8°C | | InChI | InChI=1S/C10H18/c1-9(2)7-5-6-8-10(3)4/h7-8H,5-6H2,1-4H3 | | InChIKey | PSOPUECGKNQIPH-UHFFFAOYSA-N | | SMILES | C/C(/C)=C\CC/C=C(/C)\C | | CAS DataBase Reference | 16736-42-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | RTECS | RG5830000 |
| | 2,7-dimethyl-2,6-octadiene Usage And Synthesis |
| | 2,7-dimethyl-2,6-octadiene Preparation Products And Raw materials |
|