| Company Name: |
xiamen hongyi Gold |
| Tel: |
18060930853 |
| Email: |
18060930853@163.com |
|
| | 5-Fluoro-2-nitrophenol Basic information |
| | 5-Fluoro-2-nitrophenol Chemical Properties |
| Melting point | 34-37 °C (lit.) | | Boiling point | 260°C | | density | 1.4306 (estimate) | | Fp | 197 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 6.18±0.13(Predicted) | | form | Powder, Crystals or Crystalline Mass and/or Chunks | | color | yellow | | Water Solubility | slightly soluble | | BRN | 1870311 | | Henry's Law Constant | 5.0×10-1 mol/(m3Pa) at 25℃, Tremp et al. (1993) | | InChI | InChI=1S/C6H4FNO3/c7-4-1-2-5(8(10)11)6(9)3-4/h1-3,9H | | InChIKey | QQURWFRNETXFTN-UHFFFAOYSA-N | | SMILES | C1(O)=CC(F)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 446-36-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37-36/37/39-36 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 29089000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Fluoro-2-nitrophenol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 5-Fluoro-2-nitrophenol has been used in:
- total synthesis of the (+/)-CC-1065 CPI subunit
- synthesis of 2-(7-fluoro-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)-4,5,6,7-tetrahydro-2H-isoindoline-1,3-diones
- 7-substituted 2H-1,4-benzoxazin-3-(4H)-ones, possessing therapeutic potential as inhibitors of angiogenesis
|
| | 5-Fluoro-2-nitrophenol Preparation Products And Raw materials |
|