|
|
| | 4-tert-Butyl-2-nitrophenol Basic information |
| | 4-tert-Butyl-2-nitrophenol Chemical Properties |
| Melting point | 27-29 °C(lit.) | | Boiling point | 97 °C1 mm Hg(lit.) | | density | 1.12 g/mL at 25 °C(lit.) | | refractive index | 1.5500-1.5530 | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) | | form | Yellow to Dark Yellow Oil to Semi-Solid | | pka | 7.37±0.14(Predicted) | | color | Orange to Brown | | Stability: | Hygroscopic | | InChI | 1S/C10H13NO3/c1-10(2,3)7-4-5-9(12)8(6-7)11(13)14/h4-6,12H,1-3H3 | | InChIKey | IHGNADPMUSNTJW-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc(O)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 3279-07-0(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Tert-butyl-2-nitrophenol(3279-07-0) | | EPA Substance Registry System | Phenol, 4-(1,1-dimethylethyl)-2-nitro- (3279-07-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29089990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-tert-Butyl-2-nitrophenol Usage And Synthesis |
| Chemical Properties | Yellow low melting solid | | Uses | 4-tert-Butyl-2-nitrophenol may be used for the preparation of (2-hydroxy-3-nitro-5-tert-butylbenzyl)trimethylammonium iodide. |
| | 4-tert-Butyl-2-nitrophenol Preparation Products And Raw materials |
|