|
|
| | 1-Benzyl 2-methyl (S)-(-)-1,2-aziridinedicarboxylate Basic information |
| | 1-Benzyl 2-methyl (S)-(-)-1,2-aziridinedicarboxylate Chemical Properties |
| Boiling point | 160-165 °C/2 mmHg (lit.) | | density | 1.19 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.519(lit.) | | Fp | 110 °C | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Soluble), Dichloromethane | | form | Oil | | pka | -5.65±0.40(Predicted) | | color | Colourless | | Optical Rotation | [α]20/D 25°, c = 1 in toluene | | InChI | InChI=1S/C12H13NO4/c1-16-11(14)10-7-13(10)12(15)17-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,13/m0/s1 | | InChIKey | GTZJUBQWCWZING-NKUHCKNESA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@H]1C(OC)=O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 1-Benzyl 2-methyl (S)-(-)-1,2-aziridinedicarboxylate Usage And Synthesis |
| Description | Methyl (S)-(–)-N-Z-aziridine-2-carboxylate is a chiral building block that is commonly used in the organic stereoselective synthesis of various compounds, including anticancer agents, antibiotics, and enzyme inhibitors. | | Uses | Like aziridine carboxylic acid ester derivative, (S)-1-Benzyl 2-methyl aziridine-1,2-dicarboxylate can be used for the synthetic application of chiral aziridine via esterification. | | References | [1] YUEXIAN LI . Synthesis of potent BCRP inhibitor—Ko143[J]. Tetrahedron Letters, 2008, 49 9: Pages 1480-1483. DOI: 10.1016/j.tetlet.2007.12.130
[2] FRANCESCA BARTOCCINI. Total Synthesis of ()-Clavicipitic Acid via γ,γ-Dimethylallyltryptophan (DMAT) and Chemoselective C–H Hydroxylation[J]. The Journal of Organic Chemistry, 2019, 84 12: 8027-8034. DOI: 10.1021/acs.joc.9b00879 |
| | 1-Benzyl 2-methyl (S)-(-)-1,2-aziridinedicarboxylate Preparation Products And Raw materials |
|