|
|
| | 1-(4-NITROPHENYL)-2-THIOUREA Basic information |
| | 1-(4-NITROPHENYL)-2-THIOUREA Chemical Properties |
| Melting point | 206 °C (dec.)(lit.) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | BRN | 2806574 | | InChI | 1S/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) | | InChIKey | BLYAANPIHFKKMQ-UHFFFAOYSA-N | | SMILES | NC(=S)Nc1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 3696-22-8(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2811 | | WGK Germany | 3 | | HS Code | 2930.90.2900 | | HazardClass | 6.1 | | PackingGroup | II | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(4-NITROPHENYL)-2-THIOUREA Usage And Synthesis |
| Uses | 1-(4-Nitrophenyl)-2-thiourea was used as anion sensor in organic solvent. |
| | 1-(4-NITROPHENYL)-2-THIOUREA Preparation Products And Raw materials |
|