|
|
| | 2,6-Dichloro-3-(chloromethyl)pyridine Basic information |
| Product Name: | 2,6-Dichloro-3-(chloromethyl)pyridine | | Synonyms: | 2,6-Dichloro-3-picolyl chloride;2,6-Dichloro-3-pyridylmethyl chloride;3-(Chloromethyl)-2,6-dichloropyridine;PYRIDINE, 2,6-DICHLORO-3-(CHLOROMETHYL)-;2,6-Dichlor-3-chlormethylpyridine;2,6-dichloro-5-pyridylmethyl chloride;2,6-Dichloro-3-(chloromethyl)pyridine | | CAS: | 41789-37-1 | | MF: | C6H4Cl3N | | MW: | 196.46 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 41789-37-1.mol |  |
| | 2,6-Dichloro-3-(chloromethyl)pyridine Chemical Properties |
| Melting point | 89-90° | | Boiling point | 285.5±35.0 °C(Predicted) | | density | 1.463 | | storage temp. | 2-8°C | | pka | -3.34±0.10(Predicted) | | InChI | InChI=1S/C6H4Cl3N/c7-3-4-1-2-5(8)10-6(4)9/h1-2H,3H2 | | InChIKey | CMPPTKONDXHDBF-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC=C1CCl |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2,6-Dichloro-3-(chloromethyl)pyridine Usage And Synthesis |
| | 2,6-Dichloro-3-(chloromethyl)pyridine Preparation Products And Raw materials |
|