|
|
| | 4,4'-Stilbenedicarboxylic acid Basic information |
| Product Name: | 4,4'-Stilbenedicarboxylic acid | | Synonyms: | TIMTEC-BB SBB007944;TRANS-4,4'-STILBENE-4,4'-DICARBOXYLIC ACID;4,4-Stilbenedicaroxylic acid;4,4'-stibenedicarboxylic acid;TRANS-4,4'-STIBENE-4,4'-DICARBOXYLIC ACID;4,4'-Stilbenedicarboxylic acid, 95+%;4,4'' SILBENE DICARBOXYLIC ACID;4,4''-STILBENEDICARBOXYLIC ACID 97% | | CAS: | 100-31-2 | | MF: | C16H12O4 | | MW: | 268.26 | | EINECS: | 202-838-4 | | Product Categories: | Carboxylic Acids;Phenyls & Phenyl-Het;Stilbenes;Carboxylic Acids;Phenyls & Phenyl-Het;Industrial/Fine Chemicals | | Mol File: | 100-31-2.mol |  |
| | 4,4'-Stilbenedicarboxylic acid Chemical Properties |
| Melting point | >300°C | | Boiling point | 518.5±39.0 °C(Predicted) | | density | 1.356±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.96±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C16H12O4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H,(H,17,18)(H,19,20) | | InChIKey | SBBQDUFLZGOASY-OWOJBTEDSA-N | | SMILES | C(C1=CC=C(C=C1)C(O)=O)=CC1=CC=C(C=C1)C(O)=O | | CAS DataBase Reference | 100-31-2(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4,4'-Stilbenedicarboxylic acid Usage And Synthesis |
| Chemical Properties | Light brown crystalline powder | | Uses | SDA can be used in the hydrothermal synthesis of three-dimensional (3D) metal-organic frameworks, which have potential usage in sensing, drug delivery, luminescence, and gas adsorption. It may also be used in energy storage applications such as supercapacitors and batteries. | | General Description | This product has been enhanced for energy efficiency. |
| | 4,4'-Stilbenedicarboxylic acid Preparation Products And Raw materials |
|