| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | D-(+)-Methyl-alpha-(2-thienylethamino)(2-chlorophenyl)acetate hydrochloride Basic information |
| | D-(+)-Methyl-alpha-(2-thienylethamino)(2-chlorophenyl)acetate hydrochloride Chemical Properties |
| Melting point | 180-182°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | PH | 3.3 at 25℃ and 11.07g/L | | Optical Rotation | 110.62°(C=0.010016 g/ml MEOH) | | Major Application | pharmaceutical | | InChI | InChI=1/C15H16ClNO2S.ClH/c1-19-15(18)14(12-6-2-3-7-13(12)16)17-9-8-11-5-4-10-20-11;/h2-7,10,14,17H,8-9H2,1H3;1H/t14-;/s3 | | InChIKey | ZXANKCFSGFEBQW-XOIICWPPNA-N | | SMILES | [C@H](C1C=CC=CC=1Cl)(C(=O)OC)NCCC1SC=CC=1.Cl |&1:0,r| | | CAS DataBase Reference | 141109-19-5(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | D-(+)-Methyl-alpha-(2-thienylethamino)(2-chlorophenyl)acetate hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | S(+)-N-(2-(2-Thienyl)ethyl)-2-chlorophenyl Glycine Methyl Ester Hydrochloride is an impurity from Clopidogrel (C587250) which acts as an anti-platelet agent. |
| | D-(+)-Methyl-alpha-(2-thienylethamino)(2-chlorophenyl)acetate hydrochloride Preparation Products And Raw materials |
|