| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:exo-2-Norbornyl forMate
CAS:41498-71-9
Purity:97% Package:50G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:exo-2-Norbornyl formate
CAS:41498-71-9
Purity:97% Package:50G Remarks:192937-50G
|
|
| | EXO-2-NORBORNYL FORMATE Basic information |
| Product Name: | EXO-2-NORBORNYL FORMATE | | Synonyms: | exo-2-Bicyclo[2.2.1]heptyl formate~Formic acid exo-2-norbornyl ester;EXO-2-NORBORNYL FORMATE;EXO-2-NORBORNYL FORMATE 97%;2-Exo-Norbornyl Formate;exo-2-bicyclo[2.2.1]heptyl formate;formic acid exo-2-norbornyl ester;exo-Norbornyl formate.;exo-2-Norbornyl formate,99% | | CAS: | 41498-71-9 | | MF: | C8H12O2 | | MW: | 140.18 | | EINECS: | 255-412-5 | | Product Categories: | C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 41498-71-9.mol |  |
| | EXO-2-NORBORNYL FORMATE Chemical Properties |
| Boiling point | 65-67 °C16 mm Hg(lit.) | | density | 1.048 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 129 °F | | InChI | 1S/C8H12O2/c9-5-10-8-4-6-1-2-7(8)3-6/h5-8H,1-4H2/t6-,7+,8+/m1/s1 | | InChIKey | SGXIEZNAOCVSKO-CSMHCCOUSA-N | | SMILES | O=CO[C@H]1C[C@@H]2CC[C@H]1C2 | | LogP | 1.910 (est) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | EXO-2-NORBORNYL FORMATE Usage And Synthesis |
| Uses | exo-2-norbornyl formate participates in ruthenium-catalyzed novel transformations of alkyl formates. | | General Description | exo-2-norbornyl formate participates in ruthenium-catalyzed novel transformations of alkyl formates. | | Purification Methods | Shake with NaHCO3 and distil it in vacuo (exo-borneol has m 124-126o). Alternatively mix the ester with formic acetic anhydride overnight and fractionate. [Beilstein 6 III 219.] |
| | EXO-2-NORBORNYL FORMATE Preparation Products And Raw materials |
|