| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dimethyl 3,3'-dithio-bis(propionimidate) dihydrochloride Basic information |
| Product Name: | Dimethyl 3,3'-dithio-bis(propionimidate) dihydrochloride | | Synonyms: | WANG/RICHARDS' REAGENT;WANG AND RICHARDS REAGENT;Dimethyl 3,3μ-dithio-bis(propionimidate) dihydrochloride, DTBP, Wang/Richards reagent;3,3'-Dithiobis(propanimidic acid methyl) ester;3,3'-Dithiobis(propionimidic acid methyl) ester;3-(3-imino-3-methoxy-propyl)disulfanylpropionimidic acid methyl ester;methyl 3-(3-imino-3-methoxypropyl)disulfanylpropanimidate;methyl 3-(3-imino-3-methoxy-propyl)disulfanylpropanimidate | | CAS: | 38285-78-8 | | MF: | C8H17ClN2O2S2 | | MW: | 272.81 | | EINECS: | | | Product Categories: | | | Mol File: | 38285-78-8.mol |  |
| | Dimethyl 3,3'-dithio-bis(propionimidate) dihydrochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL | | form | powder | | Water Solubility | H2O: 50mg/mL | | InChI | 1S/C8H16N2O2S2.2ClH/c1-11-7(9)3-5-13-14-6-4-8(10)12-2;;/h9-10H,3-6H2,1-2H3;2*1H | | InChIKey | CQBCVFHLZAVNPF-UHFFFAOYSA-N | | SMILES | Cl.Cl.COC(=N)CCSSCCC(=N)OC |
| Hazard Codes | Xi | | Risk Statements | 38 | | Safety Statements | 36 | | WGK Germany | 3 | | F | 3-10-21 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | Dimethyl 3,3'-dithio-bis(propionimidate) dihydrochloride Usage And Synthesis |
| Uses | Reactant for:
- Synthesis of glutathione-sensitive cross-linked polyethylenimine gene vector
- Preparation of cyclodextrin-containing polymers designed for gene delivery
- Crosslinking of chick oviduct progesterone-receptor subunits
| | reaction suitability | reagent type: cross-linking reagent |
| | Dimethyl 3,3'-dithio-bis(propionimidate) dihydrochloride Preparation Products And Raw materials |
|