| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-2-Hexenyl isovalerate Basic information |
| Product Name: | trans-2-Hexenyl isovalerate | | Synonyms: | 3-methyl-,2-hexenylester,(e)-butanoicaci;ISOVALERIC ACID TRANS-2-HEXEN-1-YL ESTER;ISOVALERIC ACID TRANS-2-HEXENYL ESTER;FEMA 3930;Isovalericacidhexenylester;(E)-hex-2-enyl isovalerate;ISOVALERIC ACID TRANS-2-HEXEN-1-YL ESTER 90+%;BUTANOICACID,3-METHYL-,2-HEXENYLESTER,(E)- | | CAS: | 68698-59-9 | | MF: | C11H20O2 | | MW: | 184.28 | | EINECS: | 272-088-0 | | Product Categories: | | | Mol File: | 68698-59-9.mol |  |
| | trans-2-Hexenyl isovalerate Chemical Properties |
| Boiling point | 231.5±9.0 °C(Predicted) | | density | 0.87 | | refractive index | 1.4300-1.4340 | | FEMA | 3930 | TRANS-2-HEXENYL ISOVALERATE | | Odor | at 10.00 % in dipropylene glycol. green waxy apple pear banana grape | | Odor Type | green | | JECFA Number | 1377 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-13-11(12)9-10(2)3/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ | | InChIKey | SAVRWHQEMHIAEB-VOTSOKGWSA-N | | SMILES | C(OC/C=C/CCC)(=O)CC(C)C | | LogP | 3.99 | | EPA Substance Registry System | (E)-2-Hexenyl isovalerate (68698-59-9) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | trans-2-Hexenyl isovalerate Usage And Synthesis |
| Chemical Properties | (E)-2-Hexenyl isovalerate has a fruity, buttery odor. | | Occurrence | Reported found in lamb’s lettuce | | Uses | flavors and fragrances | | Definition | ChEBI: 2-hexenyl isovalerate is a fatty ester resulting from the formal condensation of the carboxy group of isovaleric acid with the hydroxy group of 2-hexen-1-ol. It has a role as a volatile oil component. It is functionally related to an isovaleric acid and a 2-hexen-1-ol. | | Aroma threshold values | Aroma characteristics at 1.0%: green, fresh waxy apple, pear and banana-like with nuances of viney fusel
grape and vegetables. | | Taste threshold values | Taste characteristics at 1 to 5 ppm: green apple, fruity with an oily waxy nuance and a lingering fruity
aftertaste. |
| | trans-2-Hexenyl isovalerate Preparation Products And Raw materials |
|