| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3-Diphenyl-5-(2-thienyl)tetrazolium chloride Basic information |
| | 2,3-Diphenyl-5-(2-thienyl)tetrazolium chloride Chemical Properties |
| Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C9H8Cl2S/c10-9(11)6-8(9)12-7-4-2-1-3-5-7/h1-5,8H,6H2 | | InChIKey | RLHVMOZOYHDIGV-UHFFFAOYSA-M | | SMILES | [s]1c(ccc1)c2n[n+]([n](n2)c4ccccc4)c3ccccc3.[Cl-] |
| WGK Germany | WGK 3 | | HS Code | 2934.99.4400 | | Storage Class | 11 - Combustible Solids |
| | 2,3-Diphenyl-5-(2-thienyl)tetrazolium chloride Usage And Synthesis |
| | 2,3-Diphenyl-5-(2-thienyl)tetrazolium chloride Preparation Products And Raw materials |
|