| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Potassium 2-fluoro-5-formylphenyltrifluoroborate Basic information |
| Product Name: | Potassium 2-fluoro-5-formylphenyltrifluoroborate | | Synonyms: | CHEMMAKER CMBC-00740;Potassium trifluoro(2-fluoro-5-formylphenyl)borate;potassium:trifluoro-(2-fluoro-5-formylphenyl)boranuide;Potassium (2-fluoro-5-formylphenyl)trifluoroborate 95%;Potassium 2-fluoro-5-formyl benzenetrifluoroborate;Borate(1-), trifluoro(2-fluoro-5-formylphenyl)-, potassium (1:1), (T-4)-;2-Fluoro-5-formylphenyl potassium trifluoroborate;ium 2-fluoro-5-formylphenyltrifluoroborate | | CAS: | 1012868-70-0 | | MF: | C7H4BF4KO | | MW: | 230.0089728 | | EINECS: | | | Product Categories: | Molander Ates;Organoborons | | Mol File: | 1012868-70-0.mol |  |
| | Potassium 2-fluoro-5-formylphenyltrifluoroborate Chemical Properties |
| Melting point | 230-235°C | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | Solid | | Appearance | White to off-white Solid | | InChI | 1S/C7H4BF4O.K/c9-7-2-1-5(4-13)3-6(7)8(10,11)12;/h1-4H;/q-1;+1 | | InChIKey | HCTPXGYDPRWOOU-UHFFFAOYSA-N | | SMILES | [K+].Fc1ccc(C=O)cc1[B-](F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2932190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Potassium 2-fluoro-5-formylphenyltrifluoroborate Usage And Synthesis |
| | Potassium 2-fluoro-5-formylphenyltrifluoroborate Preparation Products And Raw materials |
|