| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Chloro-2-nitrobenzamide Basic information |
| | 5-Chloro-2-nitrobenzamide Chemical Properties |
| Melting point | 157-160 °C (lit.) | | Boiling point | 301.7±27.0 °C(Predicted) | | density | 1.520±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 14.50±0.50(Predicted) | | color | White to Yellow to Orange | | BRN | 2267797 | | InChI | 1S/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) | | InChIKey | MKHXTOPPKVFSFI-UHFFFAOYSA-N | | SMILES | NC(=O)c1cc(Cl)ccc1[N+]([O-])=O | | CAS DataBase Reference | 40763-96-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | 5-Chloro-2-nitrobenzamide Usage And Synthesis |
| | 5-Chloro-2-nitrobenzamide Preparation Products And Raw materials |
|