alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride manufacturers
|
| | alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride Basic information |
| Product Name: | alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride | | Synonyms: | alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride;Trospium Chloride Related Compound B (20 mg) ((1R,3r,5S)-8-azabicyclo[3.2.1]octan-3-yl hydroxydiphenylacetate);endo-8-Azabicyclo[3.2.1]octan-3-yl 2-hydroxy-2,2-diphenylacetate hydrochloride;endo-α-Hydroxy-α-phenylbenzeneacetic Acid 8-Azabicyclo[3.2.1]oct-3-yl Ester Hydrochloride;TrospiuM Chloride Related CoMpound B; ALPHA-HYDROXY-ALPHA-PHENYLBENZENEACETIC ACID (3-ENDO)-8-AZABICYCLO[3.2.1]OCT-3-YL ESTER HYDROCHLORID;Trospium Impurity 2(Trospium EP Impurity B);2-[3-(8-azabicyclo[3.2.1]octan-3-yl)phenyl]-2-hydroxy-2-phenylacetic acid hydrochloride | | CAS: | 63516-30-3 | | MF: | C21H23NO3.ClH | | MW: | 373.87 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 63516-30-3.mol | ![alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride Structure](CAS/GIF/63516-30-3.gif) |
| | alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | InChI=1/C21H23NO3.ClH/c23-20(25-19-13-17-11-12-18(14-19)22-17)21(24,15-7-3-1-4-8-15)16-9-5-2-6-10-16;/h1-10,17-19,22,24H,11-14H2;1H/t17-,18+,19+; | | InChIKey | VPKCUVMIEGXKID-MSFHQNQXNA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)(O)C(=O)O[C@@H]1C[C@@H]2CC[C@@H](N2)C1.Cl |&1:17,19,22,r| |
| WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 11 - Combustible Solids |
| | alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride Usage And Synthesis |
| Uses | endo-α-Hydroxy-α-phenylbenzeneacetic Acid 8-Azabicyclo[3.2.1]oct-3-yl Ester Hydrochloride, is a derivative of Trospium Chloride (T892800), which is an Antispasmodic, used in treatment of urinary incontinence. |
| | alpha-Hydroxy-alpha-phenylbenzeneacetic acid (3-endo)-8-azabicyclo[3.2.1]oct-3-yl ester hydrochloride Preparation Products And Raw materials |
|