- Benflumetol Impurity
-
- $0.00 / 10mg
-
2025-12-16
- CAS:53221-14-0
- Min. Order: 10mg
- Purity: 98
- Supply Ability: 10000000
|
| | 2-(2,7-DICHLORO-9H-FLUORENYL-4-YL)OXIRANE Basic information |
| Product Name: | 2-(2,7-DICHLORO-9H-FLUORENYL-4-YL)OXIRANE | | Synonyms: | 2-(2,7-Dichloro-9H-fluoren-4-yl)oxirane;5-Oxiranyl-2,7-dichlorofluorene;(2,7-Dichloro-9H-fluoren-4-yl)oxirane;2,( 2, 7-diCHLORO-9H FLUORENE-4-YL)OXIRANE;2-(2,7-DICHLORO-9H-FLUORENYL-4-YL)OXIRANE;Lumefantrine Epoxide;Oxirane, 2-(2,7-dichloro-9H-fluoren-4-yl)-;2-(2,7-dichloro-9h-fluorenyl-4-yl)oxirane Company Standards | | CAS: | 53221-14-0 | | MF: | C15H10Cl2O | | MW: | 277.15 | | EINECS: | 922-480-9 | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 53221-14-0.mol |  |
| | 2-(2,7-DICHLORO-9H-FLUORENYL-4-YL)OXIRANE Chemical Properties |
| Boiling point | 442.0±45.0 °C(Predicted) | | density | 1.449±0.06 g/cm3(Predicted) | | solubility | Chloroform, Dichloromethane | | form | Solid | | color | Yellow | | InChI | InChI=1S/C15H10Cl2O/c16-10-1-2-12-8(4-10)3-9-5-11(17)6-13(15(9)12)14-7-18-14/h1-2,4-6,14H,3,7H2 | | InChIKey | GVFBXSRAIWZONX-UHFFFAOYSA-N | | SMILES | O1CC1C1C2C3=C(CC=2C=C(Cl)C=1)C=C(Cl)C=C3 |
| | 2-(2,7-DICHLORO-9H-FLUORENYL-4-YL)OXIRANE Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Lumefantrine intermediate. |
| | 2-(2,7-DICHLORO-9H-FLUORENYL-4-YL)OXIRANE Preparation Products And Raw materials |
|