| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 1-(2-Chloro-6-hydroxyphenyl)ethanone Basic information |
| Product Name: | 1-(2-Chloro-6-hydroxyphenyl)ethanone | | Synonyms: | 1-(2-Chloro-6-hydroxyphenyl)ethanone;2'-Chloro-6'-hydroxyacetophenone;Ethanone, 1-(2-chloro-6-hydroxyphenyl)-;1-(2-Chloro-6-hydroxyphenyl);1-(2-Chloro-6-hydroxyphenyl)ethan-1-one 97+%;oro-6-hydroxyphenyL;2’-Chloro-6’-hydroxyacetophenone | | CAS: | 55736-04-4 | | MF: | C8H7ClO2 | | MW: | 170.59 | | EINECS: | | | Product Categories: | | | Mol File: | 55736-04-4.mol |  |
| | 1-(2-Chloro-6-hydroxyphenyl)ethanone Chemical Properties |
| Boiling point | 225.4±20.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.20±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C8H7ClO2/c1-5(10)8-6(9)3-2-4-7(8)11/h2-4,11H,1H3 | | InChIKey | RUSSVKYJPIADHS-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(O)C=CC=C1Cl)C |
| | 1-(2-Chloro-6-hydroxyphenyl)ethanone Usage And Synthesis |
| Uses | 1-(2-Chloro-6-hydroxyphenyl)ethanone is used for synthesis and structure-activity relationship of novel spiropiperidine-based stearoyl-CoA desaturase-1 inhibitors. | | Preparation | Preparation by diazotization of 2-amino-6-chloro-acetophenone, followed by hydrolysis of the obtained diazonium salt (55%). | | Synthesis | 1. To a solution of 2-chloro-6-hydroxybenzonitrile (614 mg, 4 mmol) in tetrahydrofuran (THF, 10 mL) under argon protection is slowly added a solution of methylmagnesium bromide in toluene/THF (3:1, 1.4 M, 6.4 mL, 9 mmol). Note: Gas escapes during the reaction.
2. Stir the reaction mixture at room temperature until the escape of gas ceases.
3. Transfer the reaction mixture to a sealed tube and stir overnight at 65°C. 4.
4. upon completion of the reaction, the reaction is quenched with water and acidified with aqueous hydrochloric acid.
5. The organic layer containing 1-(2-chloro-6-hydroxyphenyl)ethanone was extracted with dichloromethane (DCM).
6. The product was purified by column chromatography using dichloromethane/hexane (1:1) as eluent to afford 1-(2-chloro-6-hydroxyphenyl)ethanone (100 mg, 15% yield). | | References | [1] Patent: WO2010/56631, 2010, A1. Location in patent: Page/Page column 132-134 |
| | 1-(2-Chloro-6-hydroxyphenyl)ethanone Preparation Products And Raw materials |
|