| Company Name: |
Cochemical Ltd. Gold |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Bromo-5-trifluoromethoxypyridine manufacturers
|
| | 2-Bromo-5-trifluoromethoxypyridine Basic information |
| | 2-Bromo-5-trifluoromethoxypyridine Chemical Properties |
| Boiling point | 63-66 °C(Press: 11 Torr) | | density | 1.737±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.55±0.10(Predicted) | | form | liquid | | color | Clear, almost colourless | | InChI | InChI=1S/C6H3BrF3NO/c7-5-2-1-4(3-11-5)12-6(8,9)10/h1-3H | | InChIKey | RKXYQQVLVNEAFB-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(OC(F)(F)F)C=C1 |
| Risk Statements | 43 | | Safety Statements | 36/37 | | RIDADR | 2810 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933399990 |
| | 2-Bromo-5-trifluoromethoxypyridine Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 2-bromo-5-trifluoromethoxypyridine: 2-chloro-5-(trifluoromethoxy)pyridine (6, 7.0 g, 35.4 mmol) and bromotrimethylsilane (10.8 g, 9.3 mL, 70.8 mmol, 2 eq.) were dissolved in propionitrile (35 mL) and heated to reflux for 24 hours. The reaction process was monitored by gas chromatography (GC) to confirm 100% conversion. Upon completion of the reaction, the mixture was vacuum distilled to afford pure 2-bromo-5-trifluoromethoxypyridine (31, 7.0 g, 28.7 mmol, 81% yield) as a colorless oil. Boiling point: 63-66°C (14 mbar).
NMR data:
1H NMR (CDCl3, 300 MHz): δ= 8.34 (d, J = 2.8 Hz, 1H), 7.56 (d, J = 8.7 Hz, 1H), 7.45 (dd, J = 8.7, 2.8 Hz, 1H).
19F NMR (CDCl3, 282 MHz): δ= -58.8.
13C NMR (CDCl3, 75 MHz): δ= 145.6, 143.1, 139.2, 131.4, 129.0, 120.1 (q, J = 260 Hz).
Elemental analysis: C6H3BrF3NO (molecular weight 241)
Calculated value (%): C 29.78, H 1.25, N 5.79; measured value: C 29.96, H 1.41, N 5.64. | | References | [1] Patent: WO2010/40461, 2010, A1. Location in patent: Page/Page column 38-39
[2] European Journal of Organic Chemistry, 2010, # 31, p. 6043 - 6066 |
| | 2-Bromo-5-trifluoromethoxypyridine Preparation Products And Raw materials |
|