|
|
| | tert-butyl 1-(4-cyanophenyl)cyclobutylcarbamate Basic information |
| Product Name: | tert-butyl 1-(4-cyanophenyl)cyclobutylcarbamate | | Synonyms: | tert-butyl 1-(4-cyanophenyl)cyclobutylcarbamate;CarbaMic acid, N-[1-(4-cyanophenyl)cyclobutyl]-, 1,1-diMethylethyl ester;tert-butyl N-[1-(4-cyanophenyl)cyclobutyl]carbamate;cyclobutylcarbamate;tert-Butyl 1-(4-cyanophenyl);tert-Butyl 1-(4-cyanophenyl)cyclobutylcarbamate - C12112;1,1-Dimethylethyl N-1-(4-cyanophenyl)cyclobutylcarbamate;1-(4-Cyanophenyl)cyclobutylcarbamic acid tert-butyl ester | | CAS: | 1032349-97-5 | | MF: | C16H20N2O2 | | MW: | 272.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1032349-97-5.mol |  |
| | tert-butyl 1-(4-cyanophenyl)cyclobutylcarbamate Chemical Properties |
| density | 1.13 | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C16H20N2O2/c1-15(2,3)20-14(19)18-16(9-4-10-16)13-7-5-12(11-17)6-8-13/h5-8H,4,9-10H2,1-3H3,(H,18,19) | | InChIKey | MVZPOTHSWMRTJZ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(NC1(C2=CC=C(C#N)C=C2)CCC1)=O |
| HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids |
| | tert-butyl 1-(4-cyanophenyl)cyclobutylcarbamate Usage And Synthesis |
| | tert-butyl 1-(4-cyanophenyl)cyclobutylcarbamate Preparation Products And Raw materials |
|