|
|
| | Carbamic acid, [1-(3-aminophenyl)cyclobutyl]-, 1,1-dimethylethyl ester (9CI) Basic information |
| | Carbamic acid, [1-(3-aminophenyl)cyclobutyl]-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 427.4±34.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 12.40±0.20(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C15H22N2O2/c1-14(2,3)19-13(18)17-15(8-5-9-15)11-6-4-7-12(16)10-11/h4,6-7,10H,5,8-9,16H2,1-3H3,(H,17,18) | | InChIKey | JAELPCLFLCIGOE-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1(C2=CC=CC(N)=C2)CCC1 |
| | Carbamic acid, [1-(3-aminophenyl)cyclobutyl]-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, [1-(3-aminophenyl)cyclobutyl]-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|