|
|
| | exo-5-Norbornenecarboxylic acid Basic information |
| | exo-5-Norbornenecarboxylic acid Chemical Properties |
| Melting point | 40-44 °C | | Boiling point | 266.7±19.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | Fp | >110°C | | storage temp. | 2-8°C | | form | solid | | pka | 4.63±0.20(Predicted) | | color | White to Light Yellow and Faint Beige to Beige | | InChI | InChI=1/C8H10O2/c9-8(10)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2,(H,9,10)/t5-,6+,7+/s3 | | InChIKey | FYGUSUBEMUKACF-QXWMLGDLNA-N | | SMILES | [C@@]12([H])C[C@@]([H])(C=C1)C[C@@H]2C(O)=O |&1:0,3,8,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | RB8195000 | | HazardClass | IRRITANT |
| | exo-5-Norbornenecarboxylic acid Usage And Synthesis |
| Description | Exo-5-norbornenecarboxylic acid is a bicyclic compound that has potential applications in the field of material science due to its unique chemical properties. It is a versatile building block for the synthesis of various functional materials, including polymers, dendrimers, and self-assembled monolayers. It can be used to modify surfaces or to functionalize nanoparticles, influencing their optical, magnetic, or electronic properties. It is also often used in ring-opening metathesis polymerization reactions to form polymers with controlled molecular weight and structure. Additionally, exo-5-norbornenecarboxylic acid can function as a ligand for coordination chemistry and catalysis. | | Uses | Exo-5-norbornenecarboxylic acid can be used as:- A starting material in the synthesis of the metathesis polymer via a ring-opening metathesis polymerization (ROMP) reaction of the ester of exo-5-norbornenecarboxylic acid and 1,1μ-bi-2-naphthol.
- A monomer in the preparation of thin films via surface-initiated polymerization process. The resulting thin film serves as a template for selective deposition and etching of metal oxides, which is of significant importance in the microelectronic industry.
exo-5-Norbornenecarboxylic acid can be used as a precursor in the synthesis of:- Different crosslinkers for ring-opening metathesis polymerization.
- Norbornene-functionalized monomers, which are used to make poly(norbornene)s via ring-opening metathesis polymerization (ROMP).
- Hydrolytically cleavable and hydrolytically stable functionalized macromonomers for hydrogel preparation.
| | References | [1] IVAN V NAZAROV. Gas-Transport and the Dielectric Properties of Metathesis Polymer from the Ester of exo-5-Norbornenecarboxylic Acid and 1,1’-Bi-2-naphthol.[J]. ACS Applied Energy Materials, 2022. DOI:10.3390/polym14132697.
[2] CHRISTOPHER L. MCGANN. Thiol-ene Photocrosslinking of Cytocompatible Resilin-Like Polypeptide-PEG Hydrogels[J]. Macromolecular bioscience, 2015, 16 1: 129-138. DOI:10.1002/mabi.201500305. |
| | exo-5-Norbornenecarboxylic acid Preparation Products And Raw materials |
|