|
|
| | (E,E)-3,5-Di-O-caffeoylquinic acid Basic information |
| Product Name: | (E,E)-3,5-Di-O-caffeoylquinic acid | | Synonyms: | (E,E)-3,5-Di-O-caffeoylquinic acid;(1S,3R,4S,5R)-3,5-Bis(((E)-3-(3,4-dihydroxyphenyl)acryloyl)-oxy)-1,4-dihydroxycyclohexanecarboxyl;(3R,5R)-3,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,4-dihydroxycyclohexane-1-carboxylic acid;Cyclohexanecarboxylicacid,3,5-bis[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4-dihydroxy-,(1a,3R,4a,5R)-;3, 5-O-Dicaffeoylquinic acid;Cyclohexanecarboxylic acid, 3,5-bis[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4-dihydroxy-, (1α,3R,4α,5R)-;(1S,3R,4S,5R)-3,5-Bis(((E)-3-(3,4-dihydroxyphenyl)acryloyl)oxy)-1,4-dihydroxycyclohexanecarboxylic acid;(-)-3,5-Dicaffeoyl quinic | | CAS: | 89919-62-0 | | MF: | C25H24O12 | | MW: | 516.45 | | EINECS: | | | Product Categories: | | | Mol File: | 89919-62-0.mol |  |
| | (E,E)-3,5-Di-O-caffeoylquinic acid Chemical Properties |
| Boiling point | 826.2±65.0 °C(Predicted) | | density | 1.64 | | storage temp. | 2-8°C | | pka | 3.52±0.50(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | KRZBCHWVBQOTNZ-XLDUFQNVNA-N | | SMILES | O([C@@H]1C[C@@](O)(C(=O)O)C[C@@H](OC(=O)/C=C/C2C=CC(O)=C(O)C=2)[C@@H]1O)C(=O)/C=C/C1C=CC(O)=C(O)C=1 |&1:1,3,9,23,r| |
| | (E,E)-3,5-Di-O-caffeoylquinic acid Usage And Synthesis |
| Uses | 3,5-O-Dicaffeoylquinic acid reverses Trimethyltin-induced learning and memory deficits[1]. | | Definition | ChEBI: 3,5-di-O-caffeoyl quinic acid is a carboxylic ester that is the diester obtained by the condensation of the hydroxy groups at positions 3 and 5 of (-)-quinic acid with the carboxy group of trans-caffeic acid. Isolated from Brazilian propolis and Suaeda glauca, it exhibits hepatoprotective and cytotoxic activities. It has a role as a metabolite, a hepatoprotective agent and an antineoplastic agent. It is a cyclitol carboxylic acid and a carboxylic ester. It is functionally related to a (-)-quinic acid and a trans-caffeic acid. | | References | [1] Kang JY, et al. Reversal of Trimethyltin-Induced Learning and Memory Deficits by 3,5-Dicaffeoylquinic Acid.Oxid Med Cell Longev. 2016;2016:6981595. DOI:10.1155/2016/6981595 |
| | (E,E)-3,5-Di-O-caffeoylquinic acid Preparation Products And Raw materials |
|