| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Nigracin CAS:18463-25-7 Purity:98.0% Package:5mg Remarks:BBP01303
|
| Company Name: |
Shanghai Yongye Biotechnology Co., Ltd.
|
| Tel: |
86-021-61559134 15921386130 |
| Email: |
3423497944@qq.com |
| Products Intro: |
Product Name:Nigracin CAS:18463-25-7 Purity:HPLC>=98% Package:5mg/10mg/20mg/100mg/1g/5g
|
|
| | Nigracin Basic information |
| Product Name: | Nigracin | | Synonyms: | beta-D-Glucopyranoside 4-hydroxy-2-(hydroxymethyl)phenyl 6-benzoate;Poliothyrsoside;Xylosmoside;Nigracin;β-D-Glucopyranoside, 4-hydroxy-2-(hydroxymethyl)phenyl, 6-benzoate | | CAS: | 18463-25-7 | | MF: | C20H22O9 | | MW: | 406.38 | | EINECS: | | | Product Categories: | | | Mol File: | 18463-25-7.mol |  |
| | Nigracin Chemical Properties |
| Melting point | 205 °C (decomp) | | Boiling point | 677.6±55.0 °C(Predicted) | | density | 1.485±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | solid | | pka | 9.92±0.20(Predicted) | | biological source | plant | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | 1S/C20H22O9/c21-9-12-8-13(22)6-7-14(12)28-20-18(25)17(24)16(23)15(29-20)10-27-19(26)11-4-2-1-3-5-11/h1-8,15-18,20-25H,9-10H2/t15-,16-,17+,18-,20-/m1/s1 | | InChIKey | FLROYCKIIJCTDY-BFMVXSJESA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1COC(=O)c3ccccc3)O)O)O)Oc2c(cc(cc2)O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Nigracin Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical and biochemical research. | | Biological Activity | Poliothyrsoside is a pyruvic transaminase inhibitor known for its insulin-sensitizing effects in cell culture. Additionally, it exhibits anti-diabetic properties by inhibiting acetyl-CoA carboxylase, ultimately enhancing insulin sensitivity and lowering blood glucose levels in diabetic mice. This compound also serves as a lactate dehydrogenase inhibitor and demonstrates antidepressant-like actions, along with effectiveness against Alzheimerμs disease. In vitro studies have further revealed Poliothyrsosideμs capacity to inhibit virus production and exhibit antiviral activity against HIV-1. |
| | Nigracin Preparation Products And Raw materials |
|