| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Methoxyindole-3-acetonitrile Basic information |
| | 5-Methoxyindole-3-acetonitrile Chemical Properties |
| Melting point | 65-69 °C (lit.) | | Boiling point | 175-177 °C(Press: 0.01 Torr) | | density | 1.224±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 16.02±0.30(Predicted) | | color | Very Dark Brown | | InChI | InChI=1S/C11H10N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4H2,1H3 | | InChIKey | ZBQCXEREMRGOCO-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C(CC#N)=C1 | | CAS DataBase Reference | 2436-17-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 13 - Non Combustible Solids |
| | 5-Methoxyindole-3-acetonitrile Usage And Synthesis |
| Chemical Properties | Brown powder | | Uses | 5-Methoxyindole-3-acetonitrile is a versatile reactant used in the preparation of indole-N-acetic acid derivatives as aldose reductase inhibitors for diabetic complications treatment. It is also used in the synthesis of carboline analogs as potent MAPKAP-K2 inhibitors. | | Uses | Reactant for preparation of (-)- and (+)-debromoflustramine B and its analogues as selective butyrylcholinesterase inhibitors Reactant for preparation of carboline analogs as potent MAPKAP-K2 inhibitors Reactant for preparation of indole-N-acetic acid derivatives as aldose reductase inhibitors for diabetic complications treatment Reactant for preparation of debromoflustramine B and labeled Me(3a)-13C-physostigmine Reactant for preparation of physostigmine and physovenine Reactant for preparation of phenethyl substituted indole derivatives as melatoninergic agonists and antagonists |
| | 5-Methoxyindole-3-acetonitrile Preparation Products And Raw materials |
|