| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 2-[4-(4,5-Dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide Basic information |
| | 2-[4-(4,5-Dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide Chemical Properties |
| Melting point | 200-203°C | | Boiling point | 453.5±55.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | pka | 13.77±0.50(Predicted) | | form | powder | | InChI | 1S/C11H13N3O2S/c12-10(14-15)7-16-9-3-1-8(2-4-9)11-13-5-6-17-11/h1-4,10H,5-7,12H2 | | InChIKey | JDGLUEYONJCKBX-UHFFFAOYSA-N | | SMILES | N/C(COC1=CC=C(C=C1)C2=NCCS2)=N\O |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-[4-(4,5-Dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide Usage And Synthesis |
| | 2-[4-(4,5-Dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide Preparation Products And Raw materials |
|