| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-one Basic information |
| Product Name: | 1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-one | | Synonyms: | 1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-one;2'-Bromo-2,2,2-trifluoroacetophenone;2'-Bromo-2,2,2-trifluoroacetophenone 97%;2-Bromo-α,α,α-trifluoroacetophenone;2'-Bromo-2,2,2-trifluoroacetophenone97%;1-(2-Bromo-phenyl)-2,2,2-trifluoro-ethanone;Ethanone, 1-(2-bromophenyl)-2,2,2-trifluoro-;3-Bromo-ααα-trifluoroacetophenone | | CAS: | 244229-34-3 | | MF: | C8H4BrF3O | | MW: | 253.02 | | EINECS: | | | Product Categories: | | | Mol File: | 244229-34-3.mol |  |
| | 1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-one Chemical Properties |
| Boiling point | 230.0±40.0 °C(Predicted) | | density | 1.645 g/mL at 25 °C | | refractive index | n20/D1.495 | | Fp | 101℃ | | storage temp. | Store at room temperature | | form | liquid | | color | Clear, faint lemon | | BRN | 8312425 | | InChI | 1S/C8H4BrF3O/c9-6-4-2-1-3-5(6)7(13)8(10,11)12/h1-4H | | InChIKey | VNAWTGXXPNWISR-UHFFFAOYSA-N | | SMILES | O=C(C(F)(F)F)C1=C(Br)C=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36/37/39 | | WGK Germany | 3 | | HS Code | 2914790090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-one Usage And Synthesis |
| | 1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-one Preparation Products And Raw materials |
|