5-Chloro-2-(tributylstannyl)pyridine manufacturers
|
| | 5-Chloro-2-(tributylstannyl)pyridine Basic information |
| Product Name: | 5-Chloro-2-(tributylstannyl)pyridine | | Synonyms: | 5-Chloro-2-(tributylstannyl)pyridine;2-(Tributylstannyl)-5-chloropyridine;tributyl-(5-chloro-2-pyridyl)stannane;Pyridine, 5-chloro-2-(tributylstannyl)-;SKL974;tributyl-(5-chloropyridin-2-yl)stannane;5-Chloro-2-(tributylstannyl)pyridine - [C3117] | | CAS: | 611168-63-9 | | MF: | C17H30ClNSn | | MW: | 402.59 | | EINECS: | | | Product Categories: | | | Mol File: | 611168-63-9.mol |  |
| | 5-Chloro-2-(tributylstannyl)pyridine Chemical Properties |
| Boiling point | 392.7±52.0 °C(Predicted) | | Fp | 120℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 2.92±0.29(Predicted) | | InChI | 1S/C5H3ClN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-2,4H;3*1,3-4H2,2H3; | | InChIKey | MHSMAFNXVWZVOC-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(Cl)cn1 |
| RIDADR | UN 2788 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 5-Chloro-2-(tributylstannyl)pyridine Usage And Synthesis |
| | 5-Chloro-2-(tributylstannyl)pyridine Preparation Products And Raw materials |
|