|
|
| | 3-Chloro-2-(tributylstannyl)pyridine Basic information |
| Product Name: | 3-Chloro-2-(tributylstannyl)pyridine | | Synonyms: | 3-Chloro-2-(tributylstannyl)pyridine;2-(Tributylstannyl)-3-chloropyridine;tributyl-(3-chloropyridin-2-yl)stannane;Pyridine, 3-chloro-2-(tributylstannyl)-;tributyl-(3-chloro-2-pyridyl)stannane;SKL1087;3-chloro-2-(tributylalkaneyl)pyridine | | CAS: | 206357-78-0 | | MF: | C17H30ClNSn | | MW: | 402.59 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 206357-78-0.mol |  |
| | 3-Chloro-2-(tributylstannyl)pyridine Chemical Properties |
| Boiling point | 397.2±52.0 °C(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 2.92±0.29(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C5H3ClN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3; | | InChIKey | UPSIWQDIUJUACS-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ncccc1Cl |
| Hazard Codes | T | | Risk Statements | 23/24/25 | | Safety Statements | 36/37-45 | | RIDADR | UN 2788 6.1 / PGII | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 3-Chloro-2-(tributylstannyl)pyridine Usage And Synthesis |
| | 3-Chloro-2-(tributylstannyl)pyridine Preparation Products And Raw materials |
|