|
|
| | 2-Propenoic acid, 4'-cyano[1,1'-biphenyl]-4-yl ester Basic information |
| | 2-Propenoic acid, 4'-cyano[1,1'-biphenyl]-4-yl ester Chemical Properties |
| Boiling point | 430.1±34.0 °C(Predicted) | | density | 1.20±0.1 g/cm3 (20 ºC 760 Torr) | | InChI | InChI=1S/C16H11NO2/c1-2-16(18)19-15-9-7-14(8-10-15)13-5-3-12(11-17)4-6-13/h2-10H,1H2 | | InChIKey | LGWMDELKBMPKSQ-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(C2=CC=C(C#N)C=C2)C=C1)(=O)C=C |
| | 2-Propenoic acid, 4'-cyano[1,1'-biphenyl]-4-yl ester Usage And Synthesis |
| Uses | 2-Propenoic acid, 4'-cyano[1,1'-biphenyl]-4-yl ester is used in pharmaceutical intermediates or organic synthesis. |
| | 2-Propenoic acid, 4'-cyano[1,1'-biphenyl]-4-yl ester Preparation Products And Raw materials |
|