| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-(1-METHYLPIPERIDIN-4-YL)-1H-INDOL-5-OL MALEATE Basic information |
| | 3-(1-METHYLPIPERIDIN-4-YL)-1H-INDOL-5-OL MALEATE Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL | | form | solid | | color | white | | Water Solubility | H2O: 50mg/mL | | InChI | 1S/C14H18N2O.C4H4O4/c1-16-6-4-10(5-7-16)13-9-15-14-3-2-11(17)8-12(13)14;5-3(6)1-2-4(7)8/h2-3,8-10,15,17H,4-7H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- | | InChIKey | INGCLXPSKXSYND-BTJKTKAUSA-N | | SMILES | OC(=O)\C=C/C(O)=O.CN1CCC(CC1)c2c[nH]c3ccc(O)cc23 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(1-METHYLPIPERIDIN-4-YL)-1H-INDOL-5-OL MALEATE Usage And Synthesis |
| Uses | BRL 54443 Maleate Salt can be used in pharmacological activity and biological study of forskolin-free cAMP assay for Gi-coupled receptors. | | Biological Activity | Potent 5-HT1E/1F serotonin receptor agonist. | | in vivo | Reduction of flinching was considered as antinociception. Ipsilateral, but not contralateral, peripheral administration of BRL54443 (5-HT(1E/1F); 3-300 microg/paw) significantly reduced formalin-induced flinching in rats[3].
|
| | 3-(1-METHYLPIPERIDIN-4-YL)-1H-INDOL-5-OL MALEATE Preparation Products And Raw materials |
|