|
|
| | 4-Bromo-6-fluoro (1H)indazole Basic information | | Application |
| | 4-Bromo-6-fluoro (1H)indazole Chemical Properties |
| Boiling point | 331.3±22.0 °C(Predicted) | | density | 1.861±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.00±0.40(Predicted) | | form | solid | | color | Yellow-brown | | InChI | InChI=1S/C7H4BrFN2/c8-6-1-4(9)2-7-5(6)3-10-11-7/h1-3H,(H,10,11) | | InChIKey | VUKKRGQLFZMXNZ-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=CC(F)=C2)C=N1 |
| | 4-Bromo-6-fluoro (1H)indazole Usage And Synthesis |
| Application | 4-Bromo-6-fluoroindazole is an organic intermediate that can be prepared by first brominating 4-fluoro-2-nitrotoluene to prepare 1-bromo-5-fluoro-2-methyl-3-nitrobenzene, then reducing the nitro group to obtain 3-bromo-5-fluoro-2-methylaniline, and then cyclizing to obtain 4-bromo-6-fluoroindazole. | | Synthesis |
The preparation of 4-BROMO-6-FLUORO (1H)INDAZOLE involves the reaction of 2-methyl-3-bromo-5-fluoro-nitrobenzene with N, N-dimethylformamide dimethyl acetal in DMF, followed by condensation to obtain the intermediate ortho-nitro b-tetrahydropyrrole phenyl ethylene derivative. The intermediate is then reduced, condensed, and cyclized to form the final products.
|
| | 4-Bromo-6-fluoro (1H)indazole Preparation Products And Raw materials |
|