|
|
| | 3-Hydroxybenzylhydrazine dihydrochloride Basic information | | Uses |
| | 3-Hydroxybenzylhydrazine dihydrochloride Chemical Properties |
| Melting point | 138-140 °C(lit.) | | storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL, slightly hazy, faintly yellow | | form | Adhering Powder | | color | Off-white to beige | | Water Solubility | Soluble 50 MG/ML | | BRN | 9282965 | | InChI | 1S/C7H10N2O.2ClH/c8-9-5-6-2-1-3-7(10)4-6;;/h1-4,9-10H,5,8H2;2*1H | | InChIKey | ONOJPUDFIOEGCX-UHFFFAOYSA-N | | SMILES | Cl[H].Cl[H].NNCc1cccc(O)c1 | | CAS DataBase Reference | 81012-99-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HS Code | 29280090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 3-Hydroxybenzylhydrazine dihydrochloride Usage And Synthesis |
| Uses | Experiments have shown that 3-hydroxybenzylhydrazine can inhibit the reversal of motor deficits in MPTP-induced Parkinson's disease in primates treated with L-DOPA. | | Chemical Properties | off-white to beige adhering powder | | Biochem/physiol Actions | Inhibitor of L-aromatic amino acid decarboxylase; crosses blood brain barrier. Also inhibits GABA aminotransferase, as well as other pyridoxal-phosphate-requiring enzymes, by forming the 3-hydroxybenzylhydrazone of that cofactor. |
| | 3-Hydroxybenzylhydrazine dihydrochloride Preparation Products And Raw materials |
|