(Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate manufacturers
|
| | (Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate Basic information |
| Product Name: | (Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate | | Synonyms: | (Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate;2-Butenoic acid, 3-aMino-4-(2,4,5-trifluorophenyl)-, Methyl ester, (2Z)-;Sitagliptin Impurity 95;Methyl (2Z)-3-amino-4-(2,4,5-trifluorophenyl)-2-butenoate;(Z)-methyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate? (Sitagliptin Impurity);(Z)-Methyl3-amino-4-(2,4,5-trifluorophenyl)-2-butenoate;Methyl (Z)-3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate | | CAS: | 881995-70-6 | | MF: | C11H10F3NO2 | | MW: | 245.2 | | EINECS: | | | Product Categories: | | | Mol File: | 881995-70-6.mol |  |
| | (Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate Chemical Properties |
| Melting point | 70-71 °C | | Boiling point | 347.4±42.0 °C(Predicted) | | density | 1.325±0.06 g/cm3(Predicted) | | pka | 3.95±0.70(Predicted) | | InChI | InChI=1S/C11H10F3NO2/c1-17-11(16)4-7(15)2-6-3-9(13)10(14)5-8(6)12/h3-5H,2,15H2,1H3/b7-4- | | InChIKey | XKJLQAJESSUVAA-DAXSKMNVSA-N | | SMILES | C(OC)(=O)/C=C(\N)/CC1=CC(F)=C(F)C=C1F |
| | (Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate Usage And Synthesis |
| | (Z)-Methyl 3-aMino-4-(2,4,5-trifluorophenyl)but-2-enoate Preparation Products And Raw materials |
|