2-PIPERAZIN-1-YL-BENZOTHIAZOLE manufacturers
|
| | 2-PIPERAZIN-1-YL-BENZOTHIAZOLE Basic information |
| Product Name: | 2-PIPERAZIN-1-YL-BENZOTHIAZOLE | | Synonyms: | TIMTEC-BB SBB007362;2-PIPERAZIN-1-YL-1,3-BENZOTHIAZOLE;2-PIPERAZIN-1-YL-BENZOTHIAZOLE;2-PIPERAZINO-1,3-BENZOTHIAZOLE;CHEMBRDG-BB 4003354;BUTTPARK 51\07-05;3-(Piperazin-1-yl)-1,2-benzisothiazole;Benzothiazole, 2-(1-piperazinyl)- (9CI) | | CAS: | 55745-83-0 | | MF: | C11H13N3S | | MW: | 219.31 | | EINECS: | | | Product Categories: | BENZOTHIAZOLE | | Mol File: | 55745-83-0.mol |  |
| | 2-PIPERAZIN-1-YL-BENZOTHIAZOLE Chemical Properties |
| Melting point | 75-79℃ | | Boiling point | 370.5±52.0 °C(Predicted) | | density | 1.256 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 8.33±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H13N3S/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 | | InChIKey | LLQMZXMBCQNMJV-UHFFFAOYSA-N | | SMILES | C1(N2CCNCC2)=NC3=CC=CC=C3S1 | | CAS DataBase Reference | 55745-83-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934208090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-PIPERAZIN-1-YL-BENZOTHIAZOLE Usage And Synthesis |
| Uses | 2-(1-Piperazinyl)benzothiazole is a useful compound in the study of 1,8-Naphthyridone derivatives as potential inhibitor of HIV-1 replication. |
| | 2-PIPERAZIN-1-YL-BENZOTHIAZOLE Preparation Products And Raw materials |
|