| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Basic information |
| Product Name: | (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate | | Synonyms: | (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate;(3-Bromophenyl)(2,4,6-trimethylphenyl)iodonium trifluoromethanesulfonate;(3-Bromophenyl)mesityliodonium triflate;(3-bromophenyl)(mesityl)iodonium;(3-Bromophenyl)(mesityl)iodonium Trifluoromethanesulfonate;Iodonium, (3-bromophenyl)(2,4,6-trimethylphenyl)-, 1,1,1-trifluoromethanesulfonate (1:1);3'-bromo-2,4,6-trimethyl(diphenyliodonium) trifluoromethanesulfonate;(3-bromophenyl)-(2,4,6-trimethylphenyl)iodanium,trifluoromethanesulfonate | | CAS: | 1203709-76-5 | | MF: | C16H15BrF3IO3S | | MW: | 551.1571796 | | EINECS: | | | Product Categories: | | | Mol File: | 1203709-76-5.mol |  |
| | (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Chemical Properties |
| Melting point | 170 °C | | storage temp. | 2-8°C, sealed storage, away from moisture | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | BRN | 20041340 | | InChI | InChI=1S/C15H15BrI.CHF3O3S/c1-10-7-11(2)15(12(3)8-10)17-14-6-4-5-13(16)9-14;2-1(3,4)8(5,6)7/h4-9H,1-3H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | QTQFCDQRJRJUAN-UHFFFAOYSA-M | | SMILES | [I+](C1=CC=CC(Br)=C1)C1=C(C)C=C(C)C=C1C.S(C(F)(F)F)([O-])(=O)=O |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2904.99.5000 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Usage And Synthesis |
| | (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Preparation Products And Raw materials |
|