| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | AACOCF3 Basic information |
| Product Name: | AACOCF3 | | Synonyms: | 1,1,1-TRIFLUOROMETHYL-6,9,12,15-HEIEICOSATETRAEN-2-ONE;1,1,1-TRIFLUORO-6,9,12,15-HENEICOSATETRAEN-2-ONE;1,1,1-TRIFLUORO-6Z,9Z,12Z,15Z-HENEICOSATERAEN-2-ONE;1,1,1-TRIFLUORO-6Z,9Z-12Z,15Z-HENEICOSATETRAEN-2-ONE;AATFMK;AACOCF3;ARACHIDONYL TRIFLUOROMETHYL KETONE INHIB ITS ANANDAMIDE H;1,1,1-Trifluoromethyl-6,9,12,15-heieicosatetraen-2-one, AACOCF3, Arach-CF3 | | CAS: | 149301-79-1 | | MF: | C21H31F3O | | MW: | 356.47 | | EINECS: | | | Product Categories: | Lipid signaling | | Mol File: | 149301-79-1.mol |  |
| | AACOCF3 Chemical Properties |
| Boiling point | 421.7±45.0 °C(Predicted) | | density | 0.981±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: >5 mg/mL | | form | liquid | | color | yellow | | Stability: | Light Sensitive | | InChI | 1S/C21H31F3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(25)21(22,23)24/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3/b7-6-,10-9-,13-12-,16-15- | | InChIKey | PLWROONZUDKYKG-DOFZRALJSA-N | | SMILES | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)C(F)(F)F |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | AACOCF3 Usage And Synthesis |
| Uses | Arachidonyl trifluoromethyl ketone (AACOCF3) has been used as a anandamide degradation inhibitor to study its effects in primary astrocyte cultures. | | Definition | ChEBI: A fatty acid derivative that is arachidonic acid in which the OH part of the carboxy group has been replaced by a trifluoromethyl group | | Biological Activity | Inhibitor of cytosolic (85 kDa) phospholipase A 2 . Also inhibits fatty acid amide hydrolase (FAAH, anandamide amidase) in vitro . | | Biochem/physiol Actions | Arachidonyl trifluoromethyl ketone (AACOCF3) plays a role in the inhibition of 12-hydroxyeicosatetraenoic acid (12-HETE) and thromboxane B2 produced by the platelets. | | storage | -20°C (desiccate) | | references | [1]. ackermann ej, conde-frieboes k, dennis ea. inhibition of macrophage ca(2+)-independent phospholipase a2 by bromoenol lactone and trifluoromethyl ketones. j biol chem, 1995, 270(1): 445-450.
[2]. riendeau d, guay j, weech pk, et al. arachidonyl trifluoromethyl ketone, a potent inhibitor of 85-kda phospholipase a2, blocks production of arachidonate and 12-hydroxyeicosatetraenoic acid by calcium ionophore-challenged platelets. j biol chem, 1994, 269(22): 15619-15624.
[3]. malaviya r, ansell j, hall l, et al. targeting cytosolic phospholipase a2 by arachidonyl trifluoromethyl ketone prevents chronic inflammation in mice. eur j pharmacol, 2006, 539(3): 195-204. |
| | AACOCF3 Preparation Products And Raw materials |
|