| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | L-Methionine-methyl-13C Basic information |
| | L-Methionine-methyl-13C Chemical Properties |
| Melting point | 284 °C(lit.) | | density | 1.206±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Aqueous Acid (Slightly), Methanol (Slightly), Water (Sparingly, Heated) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +23.1°, c = 1 in 1 M HCl | | Stability: | Hygroscopic | | InChI | 1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1/i1+1 | | InChIKey | FFEARJCKVFRZRR-GBXCHUEOSA-N | | SMILES | [13CH3]SCC[C@@H](N)C(O)=O | | CAS Number Unlabeled | 63-68-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Methionine-methyl-13C Usage And Synthesis |
| Uses | L-Methionine-13C is the 13C-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Methionine-methyl-13C Preparation Products And Raw materials |
|