|
|
| | 2,2'-BIS(4,5-DIMETHYLIMIDAZOLE) Basic information |
| Product Name: | 2,2'-BIS(4,5-DIMETHYLIMIDAZOLE) | | Synonyms: | 2,2'-BIS(4,5-DIMETHYLIMIDAZOLE);2,2'-Bis(4,5-dimethylimidazole) , 70%,tech;2,2'-Bi(4,5-dimethyl-1H-imidazole);2,2'-Bi[4,5-dimethyl-1H-imidazole];4,4',5,5'-Tetramethyl-2,2'-bi(1H-imidazole);4,4',5,5'-Tetramethyl-2,2'-bi[1H-imidazole];2,2'-Bis(4,5-dimethylimidazole) technical grade;4,4,5,5-tetramethyl-2,2-bisimidazole | | CAS: | 69286-06-2 | | MF: | C10H14N4 | | MW: | 190.24 | | EINECS: | 273-955-6 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Imidazoles | | Mol File: | 69286-06-2.mol |  |
| | 2,2'-BIS(4,5-DIMETHYLIMIDAZOLE) Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 315.76°C (rough estimate) | | density | 1.1599 (rough estimate) | | refractive index | 1.5200 (estimate) | | pka | 13.59±0.10(Predicted) | | form | powder | | InChI | 1S/C10H14N4/c1-5-6(2)12-9(11-5)10-13-7(3)8(4)14-10/h1-4H3,(H,11,12)(H,13,14) | | InChIKey | YDDBHCXOIBPIFS-UHFFFAOYSA-N | | SMILES | Cc1nc([nH]c1C)-c2nc(C)c(C)[nH]2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29332990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2'-BIS(4,5-DIMETHYLIMIDAZOLE) Usage And Synthesis |
| Chemical Properties | BROWN POWDER AND CHUNKS |
| | 2,2'-BIS(4,5-DIMETHYLIMIDAZOLE) Preparation Products And Raw materials |
|