| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane Basic information |
| Product Name: | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane | | Synonyms: | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane;TRIPHENYL[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLA;bromo-triphenyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-$l^{5}-phosphane;Triphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]phosphonium Bromide;Phosphonium,triphenyl[[4-?(4,?4,?5,?5-?tetramethyl-?1,?3,?2-?dioxaborolan-?2-?yl)?phenyl]?methyl]?-?,bromide(1:1);Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)-lambda5-phosphane;(4-Methylphenylboronic acid pinacol ester)triphenylphosphonium bromide;Triphenyl[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phosphonium bromide | | CAS: | 1169942-85-1 | | MF: | C31H33BO2P.Br | | MW: | 559.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1169942-85-1.mol |  |
| | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane Chemical Properties |
| Melting point | 265-270°C | | storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C31H33BO2P.BrH/c1-30(2)31(3,4)34-32(33-30)26-22-20-25(21-23-26)24-35(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29;/h5-23H,24H2,1-4H3;1H/q+1;/p-1 | | InChIKey | QMJSYLUNLKWPAC-UHFFFAOYSA-M | | SMILES | [Br-].CC1(C)OB(OC1(C)C)c2ccc(C[P+](c3ccccc3)(c4ccccc4)c5ccccc5)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane Usage And Synthesis |
| Uses | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane (CAS# 1169942-85-1) is a lipogenic inhibitor for use in dyslipidemias and cancer. As a building block, bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane can be fluorinated for use of imaging with positron emission tomography. |
| | Bromotriphenyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)phosphorane Preparation Products And Raw materials |
|