- N-Desmethyl Iomeprol
-
- $0.00 / 1Kg/Bag
-
2026-04-23
- CAS:77868-40-7
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 10tons/month
- N-DesMethyl IoMeprol
-
- $1.00 / 1g
-
2019-12-20
- CAS:77868-40-7
- Min. Order: 200KG
- Purity: 99%
- Supply Ability: 2tons
|
| | N-DesMethyl IoMeprol Basic information |
| Product Name: | N-DesMethyl IoMeprol | | Synonyms: | N-DesMethyl IoMeprol;N,N'-Bis(2,3-dihydroxypropyl)-5-[(hydroxyacetyl)amino]-2,4,6-triiodo-1,3-benzenedicarboxamide;N,N'-bis-(2,3-dihydroxypropyl)-5-(2-hydroxyacetylamino)-2,4,6-triiodoisophthalamide;Ioversol hydrolysate;1,3-Benzenedicarboxamide,N,N'-bis(2,3-dihydroxypropyl)-5-[(hydroxyacetyl)amino]-2,4,6-triiodo-;N1,N3-Bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodo-1,3-benzenedicarboxamide;1,3-Benzenedicarboxamide, N1,N3-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodo-;N1,N3-bis(2,3-dihydroxypropyl)-5-(2-hydroxyacetamido)-2,4,6-triiodoisophthalamide | | CAS: | 77868-40-7 | | MF: | C16H20I3N3O8 | | MW: | 763.06 | | EINECS: | | | Product Categories: | Pharmaceuticals, Intermediates & Fine Chemicals;Intermediate of Ioversol;77868-40-7 | | Mol File: | 77868-40-7.mol |  |
| | N-DesMethyl IoMeprol Chemical Properties |
| Boiling point | 784.1±60.0 °C(Predicted) | | density | 2.3670 (rough estimate) | | refractive index | 1.7550 (estimate) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Water | | pka | 10.57±0.70(Predicted) | | form | Solid | | color | White | | Water Solubility | 17.68g/L(25 ºC) | | InChI | InChI=1S/C16H20I3N3O8/c17-11-9(15(29)20-1-6(26)3-23)12(18)14(22-8(28)5-25)13(19)10(11)16(30)21-2-7(27)4-24/h6-7,23-27H,1-5H2,(H,20,29)(H,21,30)(H,22,28) | | InChIKey | ZPJJDGLVOWPGAN-UHFFFAOYSA-N | | SMILES | C1(C(NCC(O)CO)=O)=C(I)C(NC(CO)=O)=C(I)C(C(NCC(O)CO)=O)=C1I |
| | N-DesMethyl IoMeprol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | N-Desmethyl Iomeprol is an intermediate used in the preparation of Iomeprol (I730500), and x-ray contrast agent. |
| | N-DesMethyl IoMeprol Preparation Products And Raw materials |
|