|
|
| | trans-4-(Boc-aMino)-3-Methoxypiperidine Basic information |
| Product Name: | trans-4-(Boc-aMino)-3-Methoxypiperidine | | Synonyms: | trans-4-(Boc-aMino)-3-Methoxypiperidine;tert-Butyl (trans-3-methoxypiperidin-4-yl)carbamate;tert-butyl N-[trans-3-methoxy-4-piperidyl]carbamate;Carbamic acid, N-[(3R,4R)-3-methoxy-4-piperidinyl]-, 1,1-dimethylethyl ester, rel-;tert-butyl Rel-((3r,4r)-3-methoxypiperidin-4-yl)carbamate | | CAS: | 1033748-33-2 | | MF: | C11H22N2O3 | | MW: | 230.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1033748-33-2.mol |  |
| | trans-4-(Boc-aMino)-3-Methoxypiperidine Chemical Properties |
| Boiling point | 332.0±42.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 11.75±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H22N2O3/c1-11(2,3)16-10(14)13-8-5-6-12-7-9(8)15-4/h8-9,12H,5-7H2,1-4H3,(H,13,14)/t8-,9-/m1/s1 | | InChIKey | BSSCFNOPCQQJAZ-RKDXNWHRSA-N | | SMILES | CO[C@H]1[C@@H](CCNC1)NC(OC(C)(C)C)=O |
| HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | trans-4-(Boc-aMino)-3-Methoxypiperidine Usage And Synthesis |
| | trans-4-(Boc-aMino)-3-Methoxypiperidine Preparation Products And Raw materials |
|