|
|
| | Boc-D-tert-Leucinol Basic information |
| Product Name: | Boc-D-tert-Leucinol | | Synonyms: | Boc-D-tert-Leucinol;N-Boc-D-tert-leucinol;(R)-tert-butyl (1-hydroxy-3,3-dimethylbutan-2-yl)carbamate(WXC08286);(R)-tert-butyl (1-hydroxy-3,3-dimethylbutan-2-yl)carbamate;tert-butyl N-[(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]carbamate;Carbamic acid, N-[(1R)-1-(hydroxymethyl)-2,2-dimethylpropyl]-, 1,1-dimethylethyl ester;N-(t-Butoxycarbonyl)-D-tert-leucinol;Boc-D-Gly(tBu)-ol | | CAS: | 142618-92-6 | | MF: | C11H23NO3 | | MW: | 217.31 | | EINECS: | | | Product Categories: | | | Mol File: | 142618-92-6.mol |  |
| | Boc-D-tert-Leucinol Chemical Properties |
| Boiling point | 313.7±25.0 °C(Predicted) | | density | 0.986±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 12.11±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H23NO3/c1-10(2,3)8(7-13)12-9(14)15-11(4,5)6/h8,13H,7H2,1-6H3,(H,12,14)/t8-/m0/s1 | | InChIKey | AZHJHZWFJVBGIL-QMMMGPOBSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H](CO)C(C)(C)C |
| | Boc-D-tert-Leucinol Usage And Synthesis |
| | Boc-D-tert-Leucinol Preparation Products And Raw materials |
|