|
|
| | SodiuM β-Hydroxyethoxyacetate Basic information |
| Product Name: | SodiuM β-Hydroxyethoxyacetate | | Synonyms: | SodiuM β-Hydroxyethoxyacetate;Acetic acid,(2-hydroxyethoxy)-,monosodium salt;SKL547;2-(2-hydroxyethoxy)acetate;2-(2-hydroxyethoxy)acetic acidsodium;HEO-AcONa;Hydroxyethyl Salicylate Impurity 4 Sodium Salt;Sodium 2-Hydroxyethoxyacetate | | CAS: | 142047-97-0 | | MF: | C4H9NaO4 | | MW: | 144.1 | | EINECS: | | | Product Categories: | | | Mol File: | 142047-97-0.mol |  |
| | SodiuM β-Hydroxyethoxyacetate Chemical Properties |
| Melting point | 210-212°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C4H8O4.Na.H/c5-1-2-8-3-4(6)7;;/h5H,1-3H2,(H,6,7);; | | InChIKey | ODEFOMJYCYOUDL-UHFFFAOYSA-N | | SMILES | C(C(=O)O)OCCO.[NaH] |
| | SodiuM β-Hydroxyethoxyacetate Usage And Synthesis |
| Uses | Sodium β-Hydroxyethoxyacetate is used in the synthesis of polymer microspheres that are magnetized and are used for enzyme catalysis or bioaffinity separations. |
| | SodiuM β-Hydroxyethoxyacetate Preparation Products And Raw materials |
|