| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(3-Phenylpropyl)pyridine N-oxide Basic information |
| | 4-(3-Phenylpropyl)pyridine N-oxide Chemical Properties |
| Melting point | 58-65 °C(lit.) | | Boiling point | 397.6±11.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | pka | 0.94±0.10(Predicted) | | form | solid | | InChI | 1S/C14H15NO/c16-15-11-9-14(10-12-15)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-12H,4,7-8H2 | | InChIKey | OOFBEJNEUVLZOW-UHFFFAOYSA-N | | SMILES | [O-][n+]1ccc(CCCc2ccccc2)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(3-Phenylpropyl)pyridine N-oxide Usage And Synthesis |
| Uses | 4-(3-Phenylpropyl)pyridine N-oxide may be employed as a donor ligand in the managnese-salen complex catalyzed asymmetric epoxidation of indene and styrene. | | General Description | 4-(3-Phenylpropyl)pyridine N-oxide (P3NO, 4-PPPyNO) participates in catalytic media for manganese-salen complex in the asymmetric epoxidation of indene. |
| | 4-(3-Phenylpropyl)pyridine N-oxide Preparation Products And Raw materials |
|