|
|
| | 2-Fluoro-5-methylbenzonitrile Basic information |
| | 2-Fluoro-5-methylbenzonitrile Chemical Properties |
| Melting point | 50-52 °C (lit.) | | Boiling point | 204 | | density | 1.11±0.1 g/cm3(Predicted) | | Fp | 201 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C8H6FN/c1-6-2-3-8(9)7(4-6)5-10/h2-4H,1H3 | | InChIKey | CMAOLVNGLTWICC-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(C)=CC=C1F | | CAS DataBase Reference | 64113-84-4(CAS DataBase Reference) |
| Hazard Codes | Xn,T | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Fluoro-5-methylbenzonitrile Usage And Synthesis |
| Uses | 2-Fluoro-5-methylbenzonitrile is used in the synthesis of indazoles which have the potential to be selective for the α2-adrenoceptor and central and peripheral nervous systems. | | General Description | 2-Fluoro-5-methylbenzonitrile is a phenolic cyanide derivative. Its vibrational spectra has been investigated. Vibrational investigations suggest that it belongs to the point group Cs. |
| | 2-Fluoro-5-methylbenzonitrile Preparation Products And Raw materials |
|