| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 7-Hydroxy-3,4,8-trimethylcoumarin Basic information |
| Product Name: | 7-Hydroxy-3,4,8-trimethylcoumarin | | Synonyms: | 7-Hydroxy-3,4,8-trimethyl-2H-chromen-2-one;7-Hydroxy-3,4,8-trimethylcoumarin 97%;7-hydroxy-3,4,8-trimethyl-2-chromenone;7-hydroxy-3,4,8-trimethyl-chromen-2-one;7-hydroxy-3,4,8-trimethylchromen-2-one;2H-1-Benzopyran-2-one, 7-hydroxy-3,4,8-trimethyl-;7-Hydroxy-3,4,8-trimethylcoumarin | | CAS: | 91963-11-0 | | MF: | C12H12O3 | | MW: | 204.22 | | EINECS: | | | Product Categories: | Building Blocks;Coumarins;Heterocyclic Building Blocks | | Mol File: | 91963-11-0.mol |  |
| | 7-Hydroxy-3,4,8-trimethylcoumarin Chemical Properties |
| Melting point | 278-280 °C (lit.) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | White to off-white Solid | | InChI | 1S/C12H12O3/c1-6-7(2)12(14)15-11-8(3)10(13)5-4-9(6)11/h4-5,13H,1-3H3 | | InChIKey | GNBLUSRSAGXTJN-UHFFFAOYSA-N | | SMILES | CC1=C(C)c2ccc(O)c(C)c2OC1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 7-Hydroxy-3,4,8-trimethylcoumarin Usage And Synthesis |
| Uses | 7-Hydroxy-3,4,8-trimethylcoumarin (cas# 91963-11-0) is a compound useful in organic synthesis. | | Uses | 7-Hydroxy-3,4,8-trimethylcoumarin has been used:
- to investigate the effect of melanin inhibiting compounds on mycelial pigmentation of Aspergillus bridgeri grown on potato dextrose agar
- in the preparation of 7-ethynyl-3,4,8-trimethylcoumarin
| | General Description | 7-Hydroxy-3,4,8-trimethylcoumarin is an inhibitor of melanin production. |
| | 7-Hydroxy-3,4,8-trimethylcoumarin Preparation Products And Raw materials |
|