|
|
| | NAPHTHALENE-2,3-DICARBOXALDEHYDE Basic information |
| | NAPHTHALENE-2,3-DICARBOXALDEHYDE Chemical Properties |
| Melting point | 131-133 °C(lit.) | | Boiling point | 380.0±25.0 °C(Predicted) | | density | 1.254±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Crystalline Powder | | color | White to pale yellow | | Appearance | Yellow solid | | BRN | 2207267 | | InChI | InChI=1S/C12H8O2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-8H | | InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC(C=O)=C1C=O | | CAS DataBase Reference | 7149-49-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 3-10-23 | | HS Code | 29122990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | NAPHTHALENE-2,3-DICARBOXALDEHYDE Usage And Synthesis |
| Description | Naphthalene-2,3-dicarboxaldehyde is a fluorogenic derivatizing probe for amines. | | Chemical Properties | Yellow Fluffy Crystalline Solid | | Uses | A useful reagent for the derivatization of primary amines, amino acids and small peptides | | Uses | Naphthalene-2,3-dicarboxaldehyde is a fluorogenic derivatizing agent for amines. |
| | NAPHTHALENE-2,3-DICARBOXALDEHYDE Preparation Products And Raw materials |
|