| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 2-formyl-3,5-dimethoxybenzoate Basic information |
| | Methyl 2-formyl-3,5-dimethoxybenzoate Chemical Properties |
| Melting point | 107-110 °C (lit.) | | Boiling point | 370.8±42.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Off-white to gray Solid | | InChI | 1S/C11H12O5/c1-14-7-4-8(11(13)16-3)9(6-12)10(5-7)15-2/h4-6H,1-3H3 | | InChIKey | HLWARVBOEGPPGB-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(OC)cc(OC)c1C=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Methyl 2-formyl-3,5-dimethoxybenzoate Usage And Synthesis |
| Uses | Methyl 2-formyl-3,5-dimethoxybenzoate may be used in the preparation of methyl (E)-3,5-dimethoxy-2-{[2-(4-methoxybenzoyl)hydrazin-1-ylidene]methyl}-benzoate. |
| | Methyl 2-formyl-3,5-dimethoxybenzoate Preparation Products And Raw materials |
|