|
|
| | 4'-Amino-biphenyl-4-carboxylic acid Basic information |
| Product Name: | 4'-Amino-biphenyl-4-carboxylic acid | | Synonyms: | AKOS BAR-0152;NSC 210547;p-(p-Aminophenyl)benzoic acid;[1,1'-Biphenyl]-4-carboxylic acid, 4'-aMino-;RARECHEM AL BO 0780;VITAS-BB TBB000335;4'-Amino-[1,1'-biphenyl]-4-carboxylic acid hydrochloride;4-(4-Aminophenyl)benzoic acid | | CAS: | 5730-78-9 | | MF: | C13H11NO2 | | MW: | 213.23 | | EINECS: | | | Product Categories: | | | Mol File: | 5730-78-9.mol |  |
| | 4'-Amino-biphenyl-4-carboxylic acid Chemical Properties |
| Melting point | 227-236℃ | | Boiling point | 421.1±28.0 °C(Predicted) | | density | 1.257 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 4.42±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H11NO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,14H2,(H,15,16) | | InChIKey | ZSFKODANZQVHCK-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C=C2)=CC=C(C(O)=O)C=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2921420090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4'-Amino-biphenyl-4-carboxylic acid Usage And Synthesis |
| Uses | 4-Aminobiphenyl-4''-carboxylic Acid, is an building block that can be used for the synthesis of Biphenyl and biphenyl ether compounds, that block DNA binding of the Human Papillomavirus (HPVs) E2 Protein, and thus can be used for the development of antiviral agents that interfere with HPV replication. |
| | 4'-Amino-biphenyl-4-carboxylic acid Preparation Products And Raw materials |
|